About bis(2-benzamidobenzoic acid);piperazine
bis(2-benzamidobenzoic acid);piperazine (PubChem CID 3045073) has the molecular formula C32H32N4O6
and a molecular weight of 568.63 g/mol. Its IUPAC name is bis(2-benzamidobenzoic acid);piperazine.
Molecular Properties
| Compound Name | bis(2-benzamidobenzoic acid);piperazine |
| PubChem CID | 3045073 |
| Molecular Formula | C32H32N4O6 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | bis(2-benzamidobenzoic acid);piperazine |
| SMILES | C1CNCCN1.O=C(Nc1ccccc1C(=O)O)c1ccccc1.O=C(Nc1ccccc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/2C14H11NO3.C4H10N2/c2*16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18;1-2-6-4-3-5-1/h2*1-9H,(H,15,16)(H,17,18);5-6H,1-4H2 |
| InChIKey | WPWVHHYAGDGQAN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-benzamidobenzoic acid);piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-benzamidobenzoic acid);piperazine?
The IUPAC name of bis(2-benzamidobenzoic acid);piperazine (CID 3045073) is bis(2-benzamidobenzoic acid);piperazine.
What is the SMILES notation for bis(2-benzamidobenzoic acid);piperazine?
The canonical SMILES for bis(2-benzamidobenzoic acid);piperazine is C1CNCCN1.O=C(Nc1ccccc1C(=O)O)c1ccccc1.O=C(Nc1ccccc1C(=O)O)c1ccccc1.
What is the InChIKey of bis(2-benzamidobenzoic acid);piperazine?
The InChIKey is WPWVHHYAGDGQAN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H11NO3.C4H10N2/c2*16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18;1-2-6-4-3-5-1/h2*1-9H,(H,15,16)(H,17,18);5-6H,1-4H2.
What are the key properties of bis(2-benzamidobenzoic acid);piperazine?
bis(2-benzamidobenzoic acid);piperazine has a molecular weight of 568.63 g/mol, XLogP of 4.45, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-benzamidobenzoic acid);piperazine is sourced from PubChem (CID 3045073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).