C26H25NO5 — CID 174534950
tert-butyl 2-benzamido-4-[(E)-2-(2-hydroxyphenyl)ethenyl]benzenecarboperoxoate (PubChem CID 174534950) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl 2-benzamido-4-[(E)-2-(2-hydroxyphenyl)ethenyl]benzenecarboperoxoate.
| Compound Name | tert-butyl 2-benzamido-4-[(E)-2-(2-hydroxyphenyl)ethenyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 174534950 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | tert-butyl 2-benzamido-4-[(E)-2-(2-hydroxyphenyl)ethenyl]benzenecarboperoxoate |
| SMILES | CC(C)(C)OOC(=O)c1ccc(/C=C/c2ccccc2O)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25NO5/c1-26(2,3)32-31-25(30)21-16-14-18(13-15-19-9-7-8-12-23(19)28)17-22(21)27-24(29)20-10-5-4-6-11-20/h4-17,28H,1-3H3,(H,27,29)/b15-13+ |
| InChIKey | FATVWRLIYKCKOK-FYWRMAATSA-N |
| XLogP | 5.70 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|