C24H18F3NO4 — CID 175252681
4-[(E)-2-(2-methoxyphenyl)ethenyl]-2-[[4-(trifluoromethyl)benzoyl]amino]benzoic acid (PubChem CID 175252681) has the molecular formula C24H18F3NO4 and a molecular weight of 441.41 g/mol. Its IUPAC name is 4-[(E)-2-(2-methoxyphenyl)ethenyl]-2-[[4-(trifluoromethyl)benzoyl]amino]benzoic acid.
| Compound Name | 4-[(E)-2-(2-methoxyphenyl)ethenyl]-2-[[4-(trifluoromethyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175252681 |
| Molecular Formula | C24H18F3NO4 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-[(E)-2-(2-methoxyphenyl)ethenyl]-2-[[4-(trifluoromethyl)benzoyl]amino]benzoic acid |
| SMILES | COc1ccccc1/C=C/c1ccc(C(=O)O)c(NC(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H18F3NO4/c1-32-21-5-3-2-4-16(21)8-6-15-7-13-19(23(30)31)20(14-15)28-22(29)17-9-11-18(12-10-17)24(25,26)27/h2-14H,1H3,(H,28,29)(H,30,31)/b8-6+ |
| InChIKey | QOKJYHWOPIUIEY-SOFGYWHQSA-N |
| XLogP | 5.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|