C31H25F3N2O5 — CID 72836395
4-[3-[(4-phenylphenyl)methylideneamino]oxypropoxy]-2-[[4-(trifluoromethyl)benzoyl]amino]benzoic acid (PubChem CID 72836395) has the molecular formula C31H25F3N2O5 and a molecular weight of 562.54 g/mol. Its IUPAC name is 4-[3-[(4-phenylphenyl)methylideneamino]oxypropoxy]-2-[[4-(trifluoromethyl)benzoyl]amino]benzoic acid.
| Compound Name | 4-[3-[(4-phenylphenyl)methylideneamino]oxypropoxy]-2-[[4-(trifluoromethyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 72836395 |
| Molecular Formula | C31H25F3N2O5 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 4-[3-[(4-phenylphenyl)methylideneamino]oxypropoxy]-2-[[4-(trifluoromethyl)benzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(OCCCON=Cc2ccc(-c3ccccc3)cc2)ccc1C(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H25F3N2O5/c32-31(33,34)25-13-11-24(12-14-25)29(37)36-28-19-26(15-16-27(28)30(38)39)40-17-4-18-41-35-20-21-7-9-23(10-8-21)22-5-2-1-3-6-22/h1-3,5-16,19-20H,4,17-18H2,(H,36,37)(H,38,39) |
| InChIKey | RMFRWKAUABXBSK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|