C37H38N2O5 — CID 86597415
methyl 4-[3-[(Z)-(4-tert-butylphenyl)methylideneamino]oxypropoxy]-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 86597415) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is methyl 4-[3-[(Z)-(4-tert-butylphenyl)methylideneamino]oxypropoxy]-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[3-[(Z)-(4-tert-butylphenyl)methylideneamino]oxypropoxy]-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 86597415 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | methyl 4-[3-[(Z)-(4-tert-butylphenyl)methylideneamino]oxypropoxy]-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(OCCCO/N=C\c2ccc(C(C)(C)C)cc2)cc1NC(=O)/C=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H38N2O5/c1-37(2,3)31-18-13-28(14-19-31)26-38-44-24-8-23-43-32-20-21-33(36(41)42-4)34(25-32)39-35(40)22-15-27-11-16-30(17-12-27)29-9-6-5-7-10-29/h5-7,9-22,25-26H,8,23-24H2,1-4H3,(H,39,40)/b22-15+,38-26- |
| InChIKey | PUHDRKNQZDBHQY-OOBIGBIISA-N |
| XLogP | 7.91 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|