C26H20F6N2O6 — CID 72959512
2-[[4-(trifluoromethoxy)benzoyl]amino]-4-[3-[[4-(trifluoromethyl)phenyl]methylideneamino]oxypropoxy]benzoic acid (PubChem CID 72959512) has the molecular formula C26H20F6N2O6 and a molecular weight of 570.44 g/mol. Its IUPAC name is 2-[[4-(trifluoromethoxy)benzoyl]amino]-4-[3-[[4-(trifluoromethyl)phenyl]methylideneamino]oxypropoxy]benzoic acid.
| Compound Name | 2-[[4-(trifluoromethoxy)benzoyl]amino]-4-[3-[[4-(trifluoromethyl)phenyl]methylideneamino]oxypropoxy]benzoic acid |
|---|---|
| PubChem CID | 72959512 |
| Molecular Formula | C26H20F6N2O6 |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 2-[[4-(trifluoromethoxy)benzoyl]amino]-4-[3-[[4-(trifluoromethyl)phenyl]methylideneamino]oxypropoxy]benzoic acid |
| SMILES | O=C(Nc1cc(OCCCON=Cc2ccc(C(F)(F)F)cc2)ccc1C(=O)O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H20F6N2O6/c27-25(28,29)18-6-2-16(3-7-18)15-33-39-13-1-12-38-20-10-11-21(24(36)37)22(14-20)34-23(35)17-4-8-19(9-5-17)40-26(30,31)32/h2-11,14-15H,1,12-13H2,(H,34,35)(H,36,37) |
| InChIKey | MVSYLMAMVOHYOS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|