C31H30F6N2O5 — CID 86597402
methyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-4-[3-[(Z)-(4-tert-butylphenyl)methylideneamino]oxypropoxy]benzoate (PubChem CID 86597402) has the molecular formula C31H30F6N2O5 and a molecular weight of 624.58 g/mol. Its IUPAC name is methyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-4-[3-[(Z)-(4-tert-butylphenyl)methylideneamino]oxypropoxy]benzoate.
| Compound Name | methyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-4-[3-[(Z)-(4-tert-butylphenyl)methylideneamino]oxypropoxy]benzoate |
|---|---|
| PubChem CID | 86597402 |
| Molecular Formula | C31H30F6N2O5 |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | methyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-4-[3-[(Z)-(4-tert-butylphenyl)methylideneamino]oxypropoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCO/N=C\c2ccc(C(C)(C)C)cc2)cc1NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H30F6N2O5/c1-29(2,3)21-8-6-19(7-9-21)18-38-44-13-5-12-43-24-10-11-25(28(41)42-4)26(17-24)39-27(40)20-14-22(30(32,33)34)16-23(15-20)31(35,36)37/h6-11,14-18H,5,12-13H2,1-4H3,(H,39,40)/b38-18- |
| InChIKey | XUKAVDJZLNJFQF-FRKGHFGRSA-N |
| XLogP | 7.88 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|