C26H20F6N2O5 — CID 11295861
2-[[2-(trifluoromethyl)benzoyl]amino]-4-[3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]oxypropoxy]benzoic acid (PubChem CID 11295861) has the molecular formula C26H20F6N2O5 and a molecular weight of 554.44 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)benzoyl]amino]-4-[3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]oxypropoxy]benzoic acid.
| Compound Name | 2-[[2-(trifluoromethyl)benzoyl]amino]-4-[3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]oxypropoxy]benzoic acid |
|---|---|
| PubChem CID | 11295861 |
| Molecular Formula | C26H20F6N2O5 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 2-[[2-(trifluoromethyl)benzoyl]amino]-4-[3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]oxypropoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCO/N=C/c2ccc(C(F)(F)F)cc2)cc1NC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H20F6N2O5/c27-25(28,29)17-8-6-16(7-9-17)15-33-39-13-3-12-38-18-10-11-20(24(36)37)22(14-18)34-23(35)19-4-1-2-5-21(19)26(30,31)32/h1-2,4-11,14-15H,3,12-13H2,(H,34,35)(H,36,37)/b33-15+ |
| InChIKey | MTSGAQITTOMICO-ROPCREHHSA-N |
| XLogP | 6.49 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|