C28H28F3NO5 — CID 72968076
4-[2-[(4-tert-butylphenyl)methylideneamino]oxyethoxy]-2-[[4-(trifluoromethyl)phenyl]methoxy]benzoic acid (PubChem CID 72968076) has the molecular formula C28H28F3NO5 and a molecular weight of 515.53 g/mol. Its IUPAC name is 4-[2-[(4-tert-butylphenyl)methylideneamino]oxyethoxy]-2-[[4-(trifluoromethyl)phenyl]methoxy]benzoic acid.
| Compound Name | 4-[2-[(4-tert-butylphenyl)methylideneamino]oxyethoxy]-2-[[4-(trifluoromethyl)phenyl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 72968076 |
| Molecular Formula | C28H28F3NO5 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 4-[2-[(4-tert-butylphenyl)methylideneamino]oxyethoxy]-2-[[4-(trifluoromethyl)phenyl]methoxy]benzoic acid |
| SMILES | CC(C)(C)c1ccc(C=NOCCOc2ccc(C(=O)O)c(OCc3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C28H28F3NO5/c1-27(2,3)21-8-4-19(5-9-21)17-32-37-15-14-35-23-12-13-24(26(33)34)25(16-23)36-18-20-6-10-22(11-7-20)28(29,30)31/h4-13,16-17H,14-15,18H2,1-3H3,(H,33,34) |
| InChIKey | WDMKWAWYLUXOIV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|