C21H25NO3 — CID 86597392
4-[3-[(4-tert-butylphenyl)methylideneamino]oxypropoxy]benzaldehyde (PubChem CID 86597392) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[3-[(4-tert-butylphenyl)methylideneamino]oxypropoxy]benzaldehyde.
| Compound Name | 4-[3-[(4-tert-butylphenyl)methylideneamino]oxypropoxy]benzaldehyde |
|---|---|
| PubChem CID | 86597392 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-[3-[(4-tert-butylphenyl)methylideneamino]oxypropoxy]benzaldehyde |
| SMILES | CC(C)(C)c1ccc(C=NOCCCOc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-21(2,3)19-9-5-17(6-10-19)15-22-25-14-4-13-24-20-11-7-18(16-23)8-12-20/h5-12,15-16H,4,13-14H2,1-3H3 |
| InChIKey | OXBVQCRRUNUKBM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|