C15H20O4 — CID 15599127
methyl 5-(4-formylphenoxy)-2,2-dimethylpentanoate (PubChem CID 15599127) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 5-(4-formylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | methyl 5-(4-formylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 15599127 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | methyl 5-(4-formylphenoxy)-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(C)(C)CCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C15H20O4/c1-15(2,14(17)18-3)9-4-10-19-13-7-5-12(11-16)6-8-13/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | MGUJMRYMITVFAM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|