About methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde
methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde (PubChem CID 178135868) has the molecular formula C24H42O5
and a molecular weight of 410.60 g/mol. Its IUPAC name is methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde.
Molecular Properties
| Compound Name | methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde |
| PubChem CID | 178135868 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde |
| SMILES | CO.COC(C)(C)C.O=CCCCCCCCCCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C18H26O3.C5H12O.CH4O/c19-14-8-6-4-2-1-3-5-7-9-15-21-18-12-10-17(16-20)11-13-18;1-5(2,3)6-4;1-2/h10-14,16H,1-9,15H2;1-4H3;2H,1H3 |
| InChIKey | MWLYOFGDIKTPPV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde?
The IUPAC name of methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde (CID 178135868) is methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde.
What is the SMILES notation for methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde?
The canonical SMILES for methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde is CO.COC(C)(C)C.O=CCCCCCCCCCCOc1ccc(C=O)cc1.
What is the InChIKey of methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde?
The InChIKey is MWLYOFGDIKTPPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3.C5H12O.CH4O/c19-14-8-6-4-2-1-3-5-7-9-15-21-18-12-10-17(16-20)11-13-18;1-5(2,3)6-4;1-2/h10-14,16H,1-9,15H2;1-4H3;2H,1H3.
What are the key properties of methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde?
methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde has a molecular weight of 410.60 g/mol, XLogP of 5.63, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methoxy-2-methylpropane;4-(11-oxoundecoxy)benzaldehyde is sourced from PubChem (CID 178135868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).