About 6-(4-formylphenoxy)hexyl formate
6-(4-formylphenoxy)hexyl formate (PubChem CID 144750186) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is 6-(4-formylphenoxy)hexyl formate.
Molecular Properties
| Compound Name | 6-(4-formylphenoxy)hexyl formate |
| PubChem CID | 144750186 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 6-(4-formylphenoxy)hexyl formate |
| SMILES | O=COCCCCCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C14H18O4/c15-11-13-5-7-14(8-6-13)18-10-4-2-1-3-9-17-12-16/h5-8,11-12H,1-4,9-10H2 |
| InChIKey | PNRUJXUMIPPMLA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-formylphenoxy)hexyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-formylphenoxy)hexyl formate?
The IUPAC name of 6-(4-formylphenoxy)hexyl formate (CID 144750186) is 6-(4-formylphenoxy)hexyl formate.
What is the SMILES notation for 6-(4-formylphenoxy)hexyl formate?
The canonical SMILES for 6-(4-formylphenoxy)hexyl formate is O=COCCCCCCOc1ccc(C=O)cc1.
What is the InChIKey of 6-(4-formylphenoxy)hexyl formate?
The InChIKey is PNRUJXUMIPPMLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c15-11-13-5-7-14(8-6-13)18-10-4-2-1-3-9-17-12-16/h5-8,11-12H,1-4,9-10H2.
What are the key properties of 6-(4-formylphenoxy)hexyl formate?
6-(4-formylphenoxy)hexyl formate has a molecular weight of 250.29 g/mol, XLogP of 2.61, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-formylphenoxy)hexyl formate is sourced from PubChem (CID 144750186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).