About 6-(4-methylphenoxy)hexyl formate
6-(4-methylphenoxy)hexyl formate (PubChem CID 143732521) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 6-(4-methylphenoxy)hexyl formate.
Molecular Properties
| Compound Name | 6-(4-methylphenoxy)hexyl formate |
| PubChem CID | 143732521 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 6-(4-methylphenoxy)hexyl formate |
| SMILES | Cc1ccc(OCCCCCCOC=O)cc1 |
| InChI | InChI=1S/C14H20O3/c1-13-6-8-14(9-7-13)17-11-5-3-2-4-10-16-12-15/h6-9,12H,2-5,10-11H2,1H3 |
| InChIKey | WYRIRDWOJQCRCG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-methylphenoxy)hexyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methylphenoxy)hexyl formate?
The IUPAC name of 6-(4-methylphenoxy)hexyl formate (CID 143732521) is 6-(4-methylphenoxy)hexyl formate.
What is the SMILES notation for 6-(4-methylphenoxy)hexyl formate?
The canonical SMILES for 6-(4-methylphenoxy)hexyl formate is Cc1ccc(OCCCCCCOC=O)cc1.
What is the InChIKey of 6-(4-methylphenoxy)hexyl formate?
The InChIKey is WYRIRDWOJQCRCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-13-6-8-14(9-7-13)17-11-5-3-2-4-10-16-12-15/h6-9,12H,2-5,10-11H2,1H3.
What are the key properties of 6-(4-methylphenoxy)hexyl formate?
6-(4-methylphenoxy)hexyl formate has a molecular weight of 236.31 g/mol, XLogP of 3.11, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methylphenoxy)hexyl formate is sourced from PubChem (CID 143732521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).