About ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene
ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 154693915) has the molecular formula C24H32O3
and a molecular weight of 368.52 g/mol. Its IUPAC name is ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene.
Molecular Properties
| Compound Name | ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene |
| PubChem CID | 154693915 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | CC.CCCCCCOc1ccc(C#Cc2ccc(C)cc2)cc1.O=CO |
| InChI | InChI=1S/C21H24O.C2H6.CH2O2/c1-3-4-5-6-17-22-21-15-13-20(14-16-21)12-11-19-9-7-18(2)8-10-19;1-2;2-1-3/h7-10,13-16H,3-6,17H2,1-2H3;1-2H3;1H,(H,2,3) |
| InChIKey | FYZVMGGPDSVDHV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene?
The IUPAC name of ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene (CID 154693915) is ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene.
What is the SMILES notation for ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene?
The canonical SMILES for ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene is CC.CCCCCCOc1ccc(C#Cc2ccc(C)cc2)cc1.O=CO.
What is the InChIKey of ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene?
The InChIKey is FYZVMGGPDSVDHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O.C2H6.CH2O2/c1-3-4-5-6-17-22-21-15-13-20(14-16-21)12-11-19-9-7-18(2)8-10-19;1-2;2-1-3/h7-10,13-16H,3-6,17H2,1-2H3;1-2H3;1H,(H,2,3).
What are the key properties of ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene?
ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene has a molecular weight of 368.52 g/mol, XLogP of 6.08, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formic acid;1-hexoxy-4-[2-(4-methylphenyl)ethynyl]benzene is sourced from PubChem (CID 154693915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).