C22H36O — CID 143066662
ethane;1-hexoxy-4-methylbenzene;(3Z)-2-methylhexa-1,3,5-triene (PubChem CID 143066662) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is ethane;1-hexoxy-4-methylbenzene;(3Z)-2-methylhexa-1,3,5-triene.
| Compound Name | ethane;1-hexoxy-4-methylbenzene;(3Z)-2-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 143066662 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | ethane;1-hexoxy-4-methylbenzene;(3Z)-2-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C\C(=C)C.CC.CCCCCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C13H20O.C7H10.C2H6/c1-3-4-5-6-11-14-13-9-7-12(2)8-10-13;1-4-5-6-7(2)3;1-2/h7-10H,3-6,11H2,1-2H3;4-6H,1-2H2,3H3;1-2H3/b;6-5-; |
| InChIKey | AWXHFIQJIPUEBR-XRPAZMCKSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|