C19H32 — CID 144729160
ethane;(3Z)-2-methylhexa-1,3,5-triene;1,4-xylene (PubChem CID 144729160) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is ethane;(3Z)-2-methylhexa-1,3,5-triene;1,4-xylene.
| Compound Name | ethane;(3Z)-2-methylhexa-1,3,5-triene;1,4-xylene |
|---|---|
| PubChem CID | 144729160 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | ethane;(3Z)-2-methylhexa-1,3,5-triene;1,4-xylene |
| SMILES | C=C/C=C\C(=C)C.CC.CC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C7H10.2C2H6/c1-7-3-5-8(2)6-4-7;1-4-5-6-7(2)3;2*1-2/h3-6H,1-2H3;4-6H,1-2H2,3H3;2*1-2H3/b;6-5-;; |
| InChIKey | LTUOFJPOVLTYPD-IMZIEXLQSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|