C21H20 — CID 145376041
1-methyl-4-[4-[(4Z)-3-methylidenehepta-1,4,6-trienyl]phenyl]benzene (PubChem CID 145376041) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-methyl-4-[4-[(4Z)-3-methylidenehepta-1,4,6-trienyl]phenyl]benzene.
| Compound Name | 1-methyl-4-[4-[(4Z)-3-methylidenehepta-1,4,6-trienyl]phenyl]benzene |
|---|---|
| PubChem CID | 145376041 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-methyl-4-[4-[(4Z)-3-methylidenehepta-1,4,6-trienyl]phenyl]benzene |
| SMILES | C=C/C=C\C(=C)C=Cc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H20/c1-4-5-6-17(2)7-10-19-11-15-21(16-12-19)20-13-8-18(3)9-14-20/h4-16H,1-2H2,3H3/b6-5-,10-7? |
| InChIKey | NZIUEVFSJRNRCT-WONFBAJKSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|