C15H17N — CID 143265110
N-methyl-4-[(1E,4Z)-3-methylidenehepta-1,4,6-trienyl]aniline (PubChem CID 143265110) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is N-methyl-4-[(1E,4Z)-3-methylidenehepta-1,4,6-trienyl]aniline.
| Compound Name | N-methyl-4-[(1E,4Z)-3-methylidenehepta-1,4,6-trienyl]aniline |
|---|---|
| PubChem CID | 143265110 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-methyl-4-[(1E,4Z)-3-methylidenehepta-1,4,6-trienyl]aniline |
| SMILES | C=C/C=C\C(=C)/C=C/c1ccc(NC)cc1 |
| InChI | InChI=1S/C15H17N/c1-4-5-6-13(2)7-8-14-9-11-15(16-3)12-10-14/h4-12,16H,1-2H2,3H3/b6-5-,8-7+ |
| InChIKey | MTZVNMAFWQUWCU-IGTJQSIKSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|