About ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline
ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline (PubChem CID 177153138) has the molecular formula C17H25N
and a molecular weight of 243.39 g/mol. Its IUPAC name is ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline.
Molecular Properties
| Compound Name | ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline |
| PubChem CID | 177153138 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline |
| SMILES | C=C/C=C(/Cc1ccc(NC)cc1)C(=C)C.CC |
| InChI | InChI=1S/C15H19N.C2H6/c1-5-6-14(12(2)3)11-13-7-9-15(16-4)10-8-13;1-2/h5-10,16H,1-2,11H2,3-4H3;1-2H3/b14-6-; |
| InChIKey | NMTRAQNTAWXIEV-WQMRFYCQSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline?
The IUPAC name of ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline (CID 177153138) is ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline.
What is the SMILES notation for ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline?
The canonical SMILES for ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline is C=C/C=C(/Cc1ccc(NC)cc1)C(=C)C.CC.
What is the InChIKey of ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline?
The InChIKey is NMTRAQNTAWXIEV-WQMRFYCQSA-N. The full InChI is InChI=1S/C15H19N.C2H6/c1-5-6-14(12(2)3)11-13-7-9-15(16-4)10-8-13;1-2/h5-10,16H,1-2,11H2,3-4H3;1-2H3/b14-6-;.
What are the key properties of ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline?
ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline has a molecular weight of 243.39 g/mol, XLogP of 4.99, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline is sourced from PubChem (CID 177153138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).