C17H25N — CID 177153138
ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline (PubChem CID 177153138) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline.
| Compound Name | ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline |
|---|---|
| PubChem CID | 177153138 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | ethane;N-methyl-4-[(2Z)-2-prop-1-en-2-ylpenta-2,4-dienyl]aniline |
| SMILES | C=C/C=C(/Cc1ccc(NC)cc1)C(=C)C.CC |
| InChI | InChI=1S/C15H19N.C2H6/c1-5-6-14(12(2)3)11-13-7-9-15(16-4)10-8-13;1-2/h5-10,16H,1-2,11H2,3-4H3;1-2H3/b14-6-; |
| InChIKey | NMTRAQNTAWXIEV-WQMRFYCQSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|