About ethane;4-ethyl-N-methylaniline;methane
ethane;4-ethyl-N-methylaniline;methane (PubChem CID 142034195) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is ethane;4-ethyl-N-methylaniline;methane.
Molecular Properties
| Compound Name | ethane;4-ethyl-N-methylaniline;methane |
| PubChem CID | 142034195 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | ethane;4-ethyl-N-methylaniline;methane |
| SMILES | C.CC.CCc1ccc(NC)cc1 |
| InChI | InChI=1S/C9H13N.C2H6.CH4/c1-3-8-4-6-9(10-2)7-5-8;1-2;/h4-7,10H,3H2,1-2H3;1-2H3;1H4 |
| InChIKey | IWUNCICEFYLIMO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-ethyl-N-methylaniline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-N-methylaniline;methane?
The IUPAC name of ethane;4-ethyl-N-methylaniline;methane (CID 142034195) is ethane;4-ethyl-N-methylaniline;methane.
What is the SMILES notation for ethane;4-ethyl-N-methylaniline;methane?
The canonical SMILES for ethane;4-ethyl-N-methylaniline;methane is C.CC.CCc1ccc(NC)cc1.
What is the InChIKey of ethane;4-ethyl-N-methylaniline;methane?
The InChIKey is IWUNCICEFYLIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C2H6.CH4/c1-3-8-4-6-9(10-2)7-5-8;1-2;/h4-7,10H,3H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;4-ethyl-N-methylaniline;methane?
ethane;4-ethyl-N-methylaniline;methane has a molecular weight of 181.32 g/mol, XLogP of 3.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-N-methylaniline;methane is sourced from PubChem (CID 142034195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).