About N-bromo-4-ethylaniline
N-bromo-4-ethylaniline (PubChem CID 118307209) has the molecular formula C8H10BrN
and a molecular weight of 200.08 g/mol. Its IUPAC name is N-bromo-4-ethylaniline.
Molecular Properties
| Compound Name | N-bromo-4-ethylaniline |
| PubChem CID | 118307209 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | N-bromo-4-ethylaniline |
| SMILES | CCc1ccc(NBr)cc1 |
| InChI | InChI=1S/C8H10BrN/c1-2-7-3-5-8(10-9)6-4-7/h3-6,10H,2H2,1H3 |
| InChIKey | FNZVPRHIURVKTR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-bromo-4-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bromo-4-ethylaniline?
The IUPAC name of N-bromo-4-ethylaniline (CID 118307209) is N-bromo-4-ethylaniline.
What is the SMILES notation for N-bromo-4-ethylaniline?
The canonical SMILES for N-bromo-4-ethylaniline is CCc1ccc(NBr)cc1.
What is the InChIKey of N-bromo-4-ethylaniline?
The InChIKey is FNZVPRHIURVKTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrN/c1-2-7-3-5-8(10-9)6-4-7/h3-6,10H,2H2,1H3.
What are the key properties of N-bromo-4-ethylaniline?
N-bromo-4-ethylaniline has a molecular weight of 200.08 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-bromo-4-ethylaniline is sourced from PubChem (CID 118307209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).