C10H17Al — CID 174296012
alumane;1,4-diethylbenzene (PubChem CID 174296012) has the molecular formula C10H17Al and a molecular weight of 164.23 g/mol. Its IUPAC name is alumane;1,4-diethylbenzene.
| Compound Name | alumane;1,4-diethylbenzene |
|---|---|
| PubChem CID | 174296012 |
| Molecular Formula | C10H17Al |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | alumane;1,4-diethylbenzene |
| SMILES | CCc1ccc(CC)cc1.[AlH3] |
| InChI | InChI=1S/C10H14.Al.3H/c1-3-9-5-7-10(4-2)8-6-9;;;;/h5-8H,3-4H2,1-2H3;;;; |
| InChIKey | JMKQRGPEUOKRMK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |