About 4-ethylaniline;hydrobromide
4-ethylaniline;hydrobromide (PubChem CID 86059477) has the molecular formula C8H12BrN
and a molecular weight of 202.10 g/mol. Its IUPAC name is 4-ethylaniline;hydrobromide.
Molecular Properties
| Compound Name | 4-ethylaniline;hydrobromide |
| PubChem CID | 86059477 |
| Molecular Formula | C8H12BrN |
| Molecular Weight | 202.10 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 4-ethylaniline;hydrobromide |
| SMILES | Br.CCc1ccc(N)cc1 |
| InChI | InChI=1S/C8H11N.BrH/c1-2-7-3-5-8(9)6-4-7;/h3-6H,2,9H2,1H3;1H |
| InChIKey | LWYXYCMLUFOUJJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.10 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylaniline;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylaniline;hydrobromide?
The IUPAC name of 4-ethylaniline;hydrobromide (CID 86059477) is 4-ethylaniline;hydrobromide.
What is the SMILES notation for 4-ethylaniline;hydrobromide?
The canonical SMILES for 4-ethylaniline;hydrobromide is Br.CCc1ccc(N)cc1.
What is the InChIKey of 4-ethylaniline;hydrobromide?
The InChIKey is LWYXYCMLUFOUJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.BrH/c1-2-7-3-5-8(9)6-4-7;/h3-6H,2,9H2,1H3;1H.
What are the key properties of 4-ethylaniline;hydrobromide?
4-ethylaniline;hydrobromide has a molecular weight of 202.10 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylaniline;hydrobromide is sourced from PubChem (CID 86059477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).