About 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline
4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline (PubChem CID 144942639) has the molecular formula C18H22N2
and a molecular weight of 266.39 g/mol. Its IUPAC name is 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline.
Molecular Properties
| Compound Name | 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline |
| PubChem CID | 144942639 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline |
| SMILES | C=C/C=C/c1ccc(N)cc1.CCc1ccc(N)cc1 |
| InChI | InChI=1S/C10H11N.C8H11N/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-7-3-5-8(9)6-4-7/h2-8H,1,11H2;3-6H,2,9H2,1H3/b4-3+; |
| InChIKey | OHXFTTHSASFSAU-BJILWQEISA-N |
| XLogP | 4.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline?
The IUPAC name of 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline (CID 144942639) is 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline.
What is the SMILES notation for 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline?
The canonical SMILES for 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline is C=C/C=C/c1ccc(N)cc1.CCc1ccc(N)cc1.
What is the InChIKey of 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline?
The InChIKey is OHXFTTHSASFSAU-BJILWQEISA-N. The full InChI is InChI=1S/C10H11N.C8H11N/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-7-3-5-8(9)6-4-7/h2-8H,1,11H2;3-6H,2,9H2,1H3/b4-3+;.
What are the key properties of 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline?
4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline has a molecular weight of 266.39 g/mol, XLogP of 4.30, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline is sourced from PubChem (CID 144942639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).