C18H22N2 — CID 144942639
4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline (PubChem CID 144942639) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline.
| Compound Name | 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline |
|---|---|
| PubChem CID | 144942639 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 4-[(1E)-buta-1,3-dienyl]aniline;4-ethylaniline |
| SMILES | C=C/C=C/c1ccc(N)cc1.CCc1ccc(N)cc1 |
| InChI | InChI=1S/C10H11N.C8H11N/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-7-3-5-8(9)6-4-7/h2-8H,1,11H2;3-6H,2,9H2,1H3/b4-3+; |
| InChIKey | OHXFTTHSASFSAU-BJILWQEISA-N |
| XLogP | 4.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|