C11H13N — CID 67805636
4-penta-1,4-dienylaniline (PubChem CID 67805636) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 4-penta-1,4-dienylaniline.
| Compound Name | 4-penta-1,4-dienylaniline |
|---|---|
| PubChem CID | 67805636 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 4-penta-1,4-dienylaniline |
| SMILES | C=CCC=Cc1ccc(N)cc1 |
| InChI | InChI=1S/C11H13N/c1-2-3-4-5-10-6-8-11(12)9-7-10/h2,4-9H,1,3,12H2 |
| InChIKey | IQZVXNVRAITPFD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|