C26H24N2 — CID 18428969
4-[(1E,3E)-4-[4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]phenyl]buta-1,3-dienyl]aniline (PubChem CID 18428969) has the molecular formula C26H24N2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[(1E,3E)-4-[4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]phenyl]buta-1,3-dienyl]aniline.
| Compound Name | 4-[(1E,3E)-4-[4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]phenyl]buta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 18428969 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-[(1E,3E)-4-[4-[(1E,3E)-4-(4-aminophenyl)buta-1,3-dienyl]phenyl]buta-1,3-dienyl]aniline |
| SMILES | Nc1ccc(/C=C/C=C/c2ccc(/C=C/C=C/c3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H24N2/c27-25-17-13-23(14-18-25)7-3-1-5-21-9-11-22(12-10-21)6-2-4-8-24-15-19-26(28)20-16-24/h1-20H,27-28H2/b5-1+,6-2+,7-3+,8-4+ |
| InChIKey | CJNWJJJRPFOJQS-VYUKIJHXSA-N |
| XLogP | 6.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|