About 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine
4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine (PubChem CID 73474151) has the molecular formula C16H21N3
and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine.
Molecular Properties
| Compound Name | 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine |
| PubChem CID | 73474151 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine |
| SMILES | CCN.Nc1ccc(C=Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C14H14N2.C2H7N/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12;1-2-3/h1-10H,15-16H2;2-3H2,1H3 |
| InChIKey | HEXYQUPMEHSUAH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine?
The IUPAC name of 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine (CID 73474151) is 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine.
What is the SMILES notation for 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine?
The canonical SMILES for 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine is CCN.Nc1ccc(C=Cc2ccc(N)cc2)cc1.
What is the InChIKey of 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine?
The InChIKey is HEXYQUPMEHSUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2.C2H7N/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12;1-2-3/h1-10H,15-16H2;2-3H2,1H3.
What are the key properties of 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine?
4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine has a molecular weight of 255.36 g/mol, XLogP of 2.99, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-aminophenyl)ethenyl]aniline;ethanamine is sourced from PubChem (CID 73474151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).