About 4-ethenylaniline;hydroiodide
4-ethenylaniline;hydroiodide (PubChem CID 175384899) has the molecular formula C8H10IN
and a molecular weight of 247.08 g/mol. Its IUPAC name is 4-ethenylaniline;hydroiodide.
Molecular Properties
| Compound Name | 4-ethenylaniline;hydroiodide |
| PubChem CID | 175384899 |
| Molecular Formula | C8H10IN |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 4-ethenylaniline;hydroiodide |
| SMILES | C=Cc1ccc(N)cc1.I |
| InChI | InChI=1S/C8H9N.HI/c1-2-7-3-5-8(9)6-4-7;/h2-6H,1,9H2;1H |
| InChIKey | WALCLDUGYLYHJN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylaniline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylaniline;hydroiodide?
The IUPAC name of 4-ethenylaniline;hydroiodide (CID 175384899) is 4-ethenylaniline;hydroiodide.
What is the SMILES notation for 4-ethenylaniline;hydroiodide?
The canonical SMILES for 4-ethenylaniline;hydroiodide is C=Cc1ccc(N)cc1.I.
What is the InChIKey of 4-ethenylaniline;hydroiodide?
The InChIKey is WALCLDUGYLYHJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.HI/c1-2-7-3-5-8(9)6-4-7;/h2-6H,1,9H2;1H.
What are the key properties of 4-ethenylaniline;hydroiodide?
4-ethenylaniline;hydroiodide has a molecular weight of 247.08 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylaniline;hydroiodide is sourced from PubChem (CID 175384899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).