About 4-ethenylaniline;prop-2-enenitrile
4-ethenylaniline;prop-2-enenitrile (PubChem CID 158730868) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-ethenylaniline;prop-2-enenitrile.
Molecular Properties
| Compound Name | 4-ethenylaniline;prop-2-enenitrile |
| PubChem CID | 158730868 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-ethenylaniline;prop-2-enenitrile |
| SMILES | C=CC#N.C=Cc1ccc(N)cc1 |
| InChI | InChI=1S/C8H9N.C3H3N/c1-2-7-3-5-8(9)6-4-7;1-2-3-4/h2-6H,1,9H2;2H,1H2 |
| InChIKey | ILBSUNPUHFCPQL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylaniline;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylaniline;prop-2-enenitrile?
The IUPAC name of 4-ethenylaniline;prop-2-enenitrile (CID 158730868) is 4-ethenylaniline;prop-2-enenitrile.
What is the SMILES notation for 4-ethenylaniline;prop-2-enenitrile?
The canonical SMILES for 4-ethenylaniline;prop-2-enenitrile is C=CC#N.C=Cc1ccc(N)cc1.
What is the InChIKey of 4-ethenylaniline;prop-2-enenitrile?
The InChIKey is ILBSUNPUHFCPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.C3H3N/c1-2-7-3-5-8(9)6-4-7;1-2-3-4/h2-6H,1,9H2;2H,1H2.
What are the key properties of 4-ethenylaniline;prop-2-enenitrile?
4-ethenylaniline;prop-2-enenitrile has a molecular weight of 172.23 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylaniline;prop-2-enenitrile is sourced from PubChem (CID 158730868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).