About 1,4-bis(ethenyl)benzene;isocyanic acid
1,4-bis(ethenyl)benzene;isocyanic acid (PubChem CID 174912365) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 1,4-bis(ethenyl)benzene;isocyanic acid.
Molecular Properties
| Compound Name | 1,4-bis(ethenyl)benzene;isocyanic acid |
| PubChem CID | 174912365 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 1,4-bis(ethenyl)benzene;isocyanic acid |
| SMILES | C=Cc1ccc(C=C)cc1.N=C=O |
| InChI | InChI=1S/C10H10.CHNO/c1-3-9-5-7-10(4-2)8-6-9;2-1-3/h3-8H,1-2H2;2H |
| InChIKey | MEHLLNPZSLXBOB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(ethenyl)benzene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(ethenyl)benzene;isocyanic acid?
The IUPAC name of 1,4-bis(ethenyl)benzene;isocyanic acid (CID 174912365) is 1,4-bis(ethenyl)benzene;isocyanic acid.
What is the SMILES notation for 1,4-bis(ethenyl)benzene;isocyanic acid?
The canonical SMILES for 1,4-bis(ethenyl)benzene;isocyanic acid is C=Cc1ccc(C=C)cc1.N=C=O.
What is the InChIKey of 1,4-bis(ethenyl)benzene;isocyanic acid?
The InChIKey is MEHLLNPZSLXBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.CHNO/c1-3-9-5-7-10(4-2)8-6-9;2-1-3/h3-8H,1-2H2;2H.
What are the key properties of 1,4-bis(ethenyl)benzene;isocyanic acid?
1,4-bis(ethenyl)benzene;isocyanic acid has a molecular weight of 173.21 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(ethenyl)benzene;isocyanic acid is sourced from PubChem (CID 174912365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).