C14H12O3 — CID 174874439
1,4-bis(ethenyl)benzene;furan-2,5-dione (PubChem CID 174874439) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1,4-bis(ethenyl)benzene;furan-2,5-dione.
| Compound Name | 1,4-bis(ethenyl)benzene;furan-2,5-dione |
|---|---|
| PubChem CID | 174874439 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1,4-bis(ethenyl)benzene;furan-2,5-dione |
| SMILES | C=Cc1ccc(C=C)cc1.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C10H10.C4H2O3/c1-3-9-5-7-10(4-2)8-6-9;5-3-1-2-4(6)7-3/h3-8H,1-2H2;1-2H |
| InChIKey | PMJMRFCPHKCDQP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|