C7H5NaO5 — CID 23684593
sodium;furan-2,5-dione;prop-2-enoate (PubChem CID 23684593) has the molecular formula C7H5NaO5 and a molecular weight of 192.10 g/mol. Its IUPAC name is sodium;furan-2,5-dione;prop-2-enoate.
| Compound Name | sodium;furan-2,5-dione;prop-2-enoate |
|---|---|
| PubChem CID | 23684593 |
| Molecular Formula | C7H5NaO5 |
| Molecular Weight | 192.10 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | sodium;furan-2,5-dione;prop-2-enoate |
| SMILES | C=CC(=O)[O-].O=C1C=CC(=O)O1.[Na+] |
| InChI | InChI=1S/C4H2O3.C3H4O2.Na/c5-3-1-2-4(6)7-3;1-2-3(4)5;/h1-2H;2H,1H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | LDLISKWWEPKHAT-UHFFFAOYSA-M |
| XLogP | -4.45 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.10 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|