About prop-2-enoate;tin(4+)
prop-2-enoate;tin(4+) (PubChem CID 22321076) has the molecular formula C3H3O2Sn+3
and a molecular weight of 189.77 g/mol. Its IUPAC name is prop-2-enoate;tin(4+).
Molecular Properties
| Compound Name | prop-2-enoate;tin(4+) |
| PubChem CID | 22321076 |
| Molecular Formula | C3H3O2Sn+3 |
| Molecular Weight | 189.77 g/mol |
| Exact Mass | 190.91 |
| IUPAC Name | prop-2-enoate;tin(4+) |
| SMILES | C=CC(=O)[O-].[Sn+4] |
| InChI | InChI=1S/C3H4O2.Sn/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+4/p-1 |
| InChIKey | GIUMLQLMMQXPIQ-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.77 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoate;tin(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoate;tin(4+)?
The IUPAC name of prop-2-enoate;tin(4+) (CID 22321076) is prop-2-enoate;tin(4+).
What is the SMILES notation for prop-2-enoate;tin(4+)?
The canonical SMILES for prop-2-enoate;tin(4+) is C=CC(=O)[O-].[Sn+4].
What is the InChIKey of prop-2-enoate;tin(4+)?
The InChIKey is GIUMLQLMMQXPIQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4O2.Sn/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+4/p-1.
What are the key properties of prop-2-enoate;tin(4+)?
prop-2-enoate;tin(4+) has a molecular weight of 189.77 g/mol, XLogP of -1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoate;tin(4+) is sourced from PubChem (CID 22321076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).