About cobalt(2+);prop-2-enoate
cobalt(2+);prop-2-enoate (PubChem CID 22476955) has the molecular formula C3H3CoO2+
and a molecular weight of 129.99 g/mol. Its IUPAC name is cobalt(2+);prop-2-enoate.
Molecular Properties
| Compound Name | cobalt(2+);prop-2-enoate |
| PubChem CID | 22476955 |
| Molecular Formula | C3H3CoO2+ |
| Molecular Weight | 129.99 g/mol |
| Exact Mass | 129.95 |
| IUPAC Name | cobalt(2+);prop-2-enoate |
| SMILES | C=CC(=O)[O-].[Co+2] |
| InChI | InChI=1S/C3H4O2.Co/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+2/p-1 |
| InChIKey | MRICJQBEKKLIEU-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.99 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);prop-2-enoate?
The IUPAC name of cobalt(2+);prop-2-enoate (CID 22476955) is cobalt(2+);prop-2-enoate.
What is the SMILES notation for cobalt(2+);prop-2-enoate?
The canonical SMILES for cobalt(2+);prop-2-enoate is C=CC(=O)[O-].[Co+2].
What is the InChIKey of cobalt(2+);prop-2-enoate?
The InChIKey is MRICJQBEKKLIEU-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4O2.Co/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+2/p-1.
What are the key properties of cobalt(2+);prop-2-enoate?
cobalt(2+);prop-2-enoate has a molecular weight of 129.99 g/mol, XLogP of -1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);prop-2-enoate is sourced from PubChem (CID 22476955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).