About prop-2-enoate sulfate
prop-2-enoate sulfate (PubChem CID 18971000) has the molecular formula C3H3O6S-3
and a molecular weight of 167.12 g/mol. Its IUPAC name is prop-2-enoate sulfate.
Molecular Properties
| Compound Name | prop-2-enoate sulfate |
| PubChem CID | 18971000 |
| Molecular Formula | C3H3O6S-3 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 166.97 |
| IUPAC Name | prop-2-enoate sulfate |
| SMILES | C=CC(=O)[O-].O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C3H4O2.H2O4S/c1-2-3(4)5;1-5(2,3)4/h2H,1H2,(H,4,5);(H2,1,2,3,4)/p-3 |
| InChIKey | VEYCPJGKKJULEP-UHFFFAOYSA-K |
| XLogP | -2.42 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoate sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoate sulfate?
The IUPAC name of prop-2-enoate sulfate (CID 18971000) is prop-2-enoate sulfate.
What is the SMILES notation for prop-2-enoate sulfate?
The canonical SMILES for prop-2-enoate sulfate is C=CC(=O)[O-].O=S(=O)([O-])[O-].
What is the InChIKey of prop-2-enoate sulfate?
The InChIKey is VEYCPJGKKJULEP-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H4O2.H2O4S/c1-2-3(4)5;1-5(2,3)4/h2H,1H2,(H,4,5);(H2,1,2,3,4)/p-3.
What are the key properties of prop-2-enoate sulfate?
prop-2-enoate sulfate has a molecular weight of 167.12 g/mol, XLogP of -2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoate sulfate is sourced from PubChem (CID 18971000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).