About europium(2+);bis(prop-2-enoate)
europium(2+);bis(prop-2-enoate) (PubChem CID 19816716) has the molecular formula C6H6EuO4
and a molecular weight of 294.07 g/mol. Its IUPAC name is europium(2+);bis(prop-2-enoate).
Molecular Properties
| Compound Name | europium(2+);bis(prop-2-enoate) |
| PubChem CID | 19816716 |
| Molecular Formula | C6H6EuO4 |
| Molecular Weight | 294.07 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | europium(2+);bis(prop-2-enoate) |
| SMILES | C=CC(=O)[O-].C=CC(=O)[O-].[Eu+2] |
| InChI | InChI=1S/2C3H4O2.Eu/c2*1-2-3(4)5;/h2*2H,1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | IPUGUCIGEIETBJ-UHFFFAOYSA-L |
| XLogP | -2.16 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.07 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze europium(2+);bis(prop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of europium(2+);bis(prop-2-enoate)?
The IUPAC name of europium(2+);bis(prop-2-enoate) (CID 19816716) is europium(2+);bis(prop-2-enoate).
What is the SMILES notation for europium(2+);bis(prop-2-enoate)?
The canonical SMILES for europium(2+);bis(prop-2-enoate) is C=CC(=O)[O-].C=CC(=O)[O-].[Eu+2].
What is the InChIKey of europium(2+);bis(prop-2-enoate)?
The InChIKey is IPUGUCIGEIETBJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H4O2.Eu/c2*1-2-3(4)5;/h2*2H,1H2,(H,4,5);/q;;+2/p-2.
What are the key properties of europium(2+);bis(prop-2-enoate)?
europium(2+);bis(prop-2-enoate) has a molecular weight of 294.07 g/mol, XLogP of -2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for europium(2+);bis(prop-2-enoate) is sourced from PubChem (CID 19816716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).