About lithium;prop-2-enoate;prop-2-enoic acid
lithium;prop-2-enoate;prop-2-enoic acid (PubChem CID 90256429) has the molecular formula C6H7LiO4
and a molecular weight of 150.06 g/mol. Its IUPAC name is lithium;prop-2-enoate;prop-2-enoic acid.
Molecular Properties
| Compound Name | lithium;prop-2-enoate;prop-2-enoic acid |
| PubChem CID | 90256429 |
| Molecular Formula | C6H7LiO4 |
| Molecular Weight | 150.06 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | lithium;prop-2-enoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=CC(=O)[O-].[Li+] |
| InChI | InChI=1S/2C3H4O2.Li/c2*1-2-3(4)5;/h2*2H,1H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | RSCQMCGZVWVYRB-UHFFFAOYSA-M |
| XLogP | -3.82 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.06 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;prop-2-enoate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;prop-2-enoate;prop-2-enoic acid?
The IUPAC name of lithium;prop-2-enoate;prop-2-enoic acid (CID 90256429) is lithium;prop-2-enoate;prop-2-enoic acid.
What is the SMILES notation for lithium;prop-2-enoate;prop-2-enoic acid?
The canonical SMILES for lithium;prop-2-enoate;prop-2-enoic acid is C=CC(=O)O.C=CC(=O)[O-].[Li+].
What is the InChIKey of lithium;prop-2-enoate;prop-2-enoic acid?
The InChIKey is RSCQMCGZVWVYRB-UHFFFAOYSA-M. The full InChI is InChI=1S/2C3H4O2.Li/c2*1-2-3(4)5;/h2*2H,1H2,(H,4,5);/q;;+1/p-1.
What are the key properties of lithium;prop-2-enoate;prop-2-enoic acid?
lithium;prop-2-enoate;prop-2-enoic acid has a molecular weight of 150.06 g/mol, XLogP of -3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;prop-2-enoate;prop-2-enoic acid is sourced from PubChem (CID 90256429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).