About magnesium;2-chloroacetate;prop-2-enoate
magnesium;2-chloroacetate;prop-2-enoate (PubChem CID 22987449) has the molecular formula C5H5ClMgO4
and a molecular weight of 188.85 g/mol. Its IUPAC name is magnesium;2-chloroacetate;prop-2-enoate.
Molecular Properties
| Compound Name | magnesium;2-chloroacetate;prop-2-enoate |
| PubChem CID | 22987449 |
| Molecular Formula | C5H5ClMgO4 |
| Molecular Weight | 188.85 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | magnesium;2-chloroacetate;prop-2-enoate |
| SMILES | C=CC(=O)[O-].O=C([O-])CCl.[Mg+2] |
| InChI | InChI=1S/C3H4O2.C2H3ClO2.Mg/c1-2-3(4)5;3-1-2(4)5;/h2H,1H2,(H,4,5);1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | JUQUHSNKIGGARQ-UHFFFAOYSA-L |
| XLogP | -2.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.85 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-chloroacetate;prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-chloroacetate;prop-2-enoate?
The IUPAC name of magnesium;2-chloroacetate;prop-2-enoate (CID 22987449) is magnesium;2-chloroacetate;prop-2-enoate.
What is the SMILES notation for magnesium;2-chloroacetate;prop-2-enoate?
The canonical SMILES for magnesium;2-chloroacetate;prop-2-enoate is C=CC(=O)[O-].O=C([O-])CCl.[Mg+2].
What is the InChIKey of magnesium;2-chloroacetate;prop-2-enoate?
The InChIKey is JUQUHSNKIGGARQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H4O2.C2H3ClO2.Mg/c1-2-3(4)5;3-1-2(4)5;/h2H,1H2,(H,4,5);1H2,(H,4,5);/q;;+2/p-2.
What are the key properties of magnesium;2-chloroacetate;prop-2-enoate?
magnesium;2-chloroacetate;prop-2-enoate has a molecular weight of 188.85 g/mol, XLogP of -2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-chloroacetate;prop-2-enoate is sourced from PubChem (CID 22987449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).