About beryllium bis(2-chloroacetate)
beryllium bis(2-chloroacetate) (PubChem CID 146405283) has the molecular formula C4H4BeCl2O4
and a molecular weight of 195.99 g/mol. Its IUPAC name is beryllium bis(2-chloroacetate).
Molecular Properties
| Compound Name | beryllium bis(2-chloroacetate) |
| PubChem CID | 146405283 |
| Molecular Formula | C4H4BeCl2O4 |
| Molecular Weight | 195.99 g/mol |
| Exact Mass | 194.96 |
| IUPAC Name | beryllium bis(2-chloroacetate) |
| SMILES | O=C([O-])CCl.O=C([O-])CCl.[Be+2] |
| InChI | InChI=1S/2C2H3ClO2.Be/c2*3-1-2(4)5;/h2*1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | CKZIUNQPEVTOOH-UHFFFAOYSA-L |
| XLogP | -2.43 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.99 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze beryllium bis(2-chloroacetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium bis(2-chloroacetate)?
The IUPAC name of beryllium bis(2-chloroacetate) (CID 146405283) is beryllium bis(2-chloroacetate).
What is the SMILES notation for beryllium bis(2-chloroacetate)?
The canonical SMILES for beryllium bis(2-chloroacetate) is O=C([O-])CCl.O=C([O-])CCl.[Be+2].
What is the InChIKey of beryllium bis(2-chloroacetate)?
The InChIKey is CKZIUNQPEVTOOH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H3ClO2.Be/c2*3-1-2(4)5;/h2*1H2,(H,4,5);/q;;+2/p-2.
What are the key properties of beryllium bis(2-chloroacetate)?
beryllium bis(2-chloroacetate) has a molecular weight of 195.99 g/mol, XLogP of -2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium bis(2-chloroacetate) is sourced from PubChem (CID 146405283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).