About 3-chloro-2-oxopropanoate
3-chloro-2-oxopropanoate (PubChem CID 51409882) has the molecular formula C3H2ClO3-
and a molecular weight of 121.50 g/mol. Its IUPAC name is 3-chloro-2-oxopropanoate.
Molecular Properties
| Compound Name | 3-chloro-2-oxopropanoate |
| PubChem CID | 51409882 |
| Molecular Formula | C3H2ClO3- |
| Molecular Weight | 121.50 g/mol |
| Exact Mass | 120.97 |
| IUPAC Name | 3-chloro-2-oxopropanoate |
| SMILES | O=C([O-])C(=O)CCl |
| InChI | InChI=1S/C3H3ClO3/c4-1-2(5)3(6)7/h1H2,(H,6,7)/p-1 |
| InChIKey | RCWFNCXDFSOVLG-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.50 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-oxopropanoate?
The IUPAC name of 3-chloro-2-oxopropanoate (CID 51409882) is 3-chloro-2-oxopropanoate.
What is the SMILES notation for 3-chloro-2-oxopropanoate?
The canonical SMILES for 3-chloro-2-oxopropanoate is O=C([O-])C(=O)CCl.
What is the InChIKey of 3-chloro-2-oxopropanoate?
The InChIKey is RCWFNCXDFSOVLG-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H3ClO3/c4-1-2(5)3(6)7/h1H2,(H,6,7)/p-1.
What are the key properties of 3-chloro-2-oxopropanoate?
3-chloro-2-oxopropanoate has a molecular weight of 121.50 g/mol, XLogP of -1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-oxopropanoate is sourced from PubChem (CID 51409882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).