About cerium;oxalate
cerium;oxalate (PubChem CID 8762) has the molecular formula C2Ce2O4-2
and a molecular weight of 368.25 g/mol. Its IUPAC name is cerium;oxalate.
Molecular Properties
| Compound Name | cerium;oxalate |
| PubChem CID | 8762 |
| Molecular Formula | C2Ce2O4-2 |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 367.79 |
| IUPAC Name | cerium;oxalate |
| SMILES | O=C([O-])C(=O)[O-].[Ce].[Ce] |
| InChI | InChI=1S/C2H2O4.2Ce/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/p-2 |
| InChIKey | VMQRILJWEHBRPV-UHFFFAOYSA-L |
| XLogP | -3.51 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cerium;oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;oxalate?
The IUPAC name of cerium;oxalate (CID 8762) is cerium;oxalate.
What is the SMILES notation for cerium;oxalate?
The canonical SMILES for cerium;oxalate is O=C([O-])C(=O)[O-].[Ce].[Ce].
What is the InChIKey of cerium;oxalate?
The InChIKey is VMQRILJWEHBRPV-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.2Ce/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/p-2.
What are the key properties of cerium;oxalate?
cerium;oxalate has a molecular weight of 368.25 g/mol, XLogP of -3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;oxalate is sourced from PubChem (CID 8762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).