About cesium oxalate
cesium oxalate (PubChem CID 53436195) has the molecular formula C2CsO4-
and a molecular weight of 220.92 g/mol. Its IUPAC name is cesium oxalate.
Molecular Properties
| Compound Name | cesium oxalate |
| PubChem CID | 53436195 |
| Molecular Formula | C2CsO4- |
| Molecular Weight | 220.92 g/mol |
| Exact Mass | 220.89 |
| IUPAC Name | cesium oxalate |
| SMILES | O=C([O-])C(=O)[O-].[Cs+] |
| InChI | InChI=1S/C2H2O4.Cs/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+1/p-2 |
| InChIKey | VYWZGWMEBNSXAD-UHFFFAOYSA-L |
| XLogP | -6.51 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.92 |
| LogP ≤ 5 | -6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cesium oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium oxalate?
The IUPAC name of cesium oxalate (CID 53436195) is cesium oxalate.
What is the SMILES notation for cesium oxalate?
The canonical SMILES for cesium oxalate is O=C([O-])C(=O)[O-].[Cs+].
What is the InChIKey of cesium oxalate?
The InChIKey is VYWZGWMEBNSXAD-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.Cs/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+1/p-2.
What are the key properties of cesium oxalate?
cesium oxalate has a molecular weight of 220.92 g/mol, XLogP of -6.51, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cesium oxalate is sourced from PubChem (CID 53436195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).