About diazanium;oxalate
diazanium;oxalate (PubChem CID 14213) has the molecular formula C2H8N2O4
and a molecular weight of 124.10 g/mol. Its IUPAC name is diazanium;oxalate.
Molecular Properties
| Compound Name | diazanium;oxalate |
| PubChem CID | 14213 |
| Molecular Formula | C2H8N2O4 |
| Molecular Weight | 124.10 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | diazanium;oxalate |
| SMILES | O=C([O-])C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C2H2O4.2H3N/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H3 |
| InChIKey | VBIXEXWLHSRNKB-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 153.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.10 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze diazanium;oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;oxalate?
The IUPAC name of diazanium;oxalate (CID 14213) is diazanium;oxalate.
What is the SMILES notation for diazanium;oxalate?
The canonical SMILES for diazanium;oxalate is O=C([O-])C(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;oxalate?
The InChIKey is VBIXEXWLHSRNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.2H3N/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H3.
What are the key properties of diazanium;oxalate?
diazanium;oxalate has a molecular weight of 124.10 g/mol, XLogP of -2.76, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;oxalate is sourced from PubChem (CID 14213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).