About azanium;oxalate;zirconium
azanium;oxalate;zirconium (PubChem CID 87076848) has the molecular formula C2H4NO4Zr-
and a molecular weight of 197.28 g/mol. Its IUPAC name is azanium;oxalate;zirconium.
Molecular Properties
| Compound Name | azanium;oxalate;zirconium |
| PubChem CID | 87076848 |
| Molecular Formula | C2H4NO4Zr- |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 195.92 |
| IUPAC Name | azanium;oxalate;zirconium |
| SMILES | O=C([O-])C(=O)[O-].[NH4+].[Zr] |
| InChI | InChI=1S/C2H2O4.H3N.Zr/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);1H3;/p-1 |
| InChIKey | NGMLRHWRDWEBDQ-UHFFFAOYSA-M |
| XLogP | -3.14 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze azanium;oxalate;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;oxalate;zirconium?
The IUPAC name of azanium;oxalate;zirconium (CID 87076848) is azanium;oxalate;zirconium.
What is the SMILES notation for azanium;oxalate;zirconium?
The canonical SMILES for azanium;oxalate;zirconium is O=C([O-])C(=O)[O-].[NH4+].[Zr].
What is the InChIKey of azanium;oxalate;zirconium?
The InChIKey is NGMLRHWRDWEBDQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2O4.H3N.Zr/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);1H3;/p-1.
What are the key properties of azanium;oxalate;zirconium?
azanium;oxalate;zirconium has a molecular weight of 197.28 g/mol, XLogP of -3.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;oxalate;zirconium is sourced from PubChem (CID 87076848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).