About oxalate;yttrium(3+)
oxalate;yttrium(3+) (PubChem CID 21124343) has the molecular formula C2O4Y+
and a molecular weight of 176.92 g/mol. Its IUPAC name is oxalate;yttrium(3+).
Molecular Properties
| Compound Name | oxalate;yttrium(3+) |
| PubChem CID | 21124343 |
| Molecular Formula | C2O4Y+ |
| Molecular Weight | 176.92 g/mol |
| Exact Mass | 176.88 |
| IUPAC Name | oxalate;yttrium(3+) |
| SMILES | O=C([O-])C(=O)[O-].[Y+3] |
| InChI | InChI=1S/C2H2O4.Y/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+3/p-2 |
| InChIKey | XQWMNFVCVIRCPC-UHFFFAOYSA-L |
| XLogP | -3.52 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.92 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalate;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalate;yttrium(3+)?
The IUPAC name of oxalate;yttrium(3+) (CID 21124343) is oxalate;yttrium(3+).
What is the SMILES notation for oxalate;yttrium(3+)?
The canonical SMILES for oxalate;yttrium(3+) is O=C([O-])C(=O)[O-].[Y+3].
What is the InChIKey of oxalate;yttrium(3+)?
The InChIKey is XQWMNFVCVIRCPC-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.Y/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+3/p-2.
What are the key properties of oxalate;yttrium(3+)?
oxalate;yttrium(3+) has a molecular weight of 176.92 g/mol, XLogP of -3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxalate;yttrium(3+) is sourced from PubChem (CID 21124343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).