About oxalate;silicon(4+)
oxalate;silicon(4+) (PubChem CID 19840044) has the molecular formula C4H8O8Si
and a molecular weight of 212.19 g/mol. Its IUPAC name is oxalate;silicon(4+).
Molecular Properties
| Compound Name | oxalate;silicon(4+) |
| PubChem CID | 19840044 |
| Molecular Formula | C4H8O8Si |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | oxalate;silicon(4+) |
| SMILES | O=C([O-])C(=O)[O-].O=C([O-])C(=O)[O-].[SiH8+4] |
| InChI | InChI=1S/2C2H2O4.H8Si/c2*3-1(4)2(5)6;/h2*(H,3,4)(H,5,6);1H8/q;;+4/p-4 |
| InChIKey | JCGBUPUXFOYNQF-UHFFFAOYSA-J |
| XLogP | -9.55 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | -9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxalate;silicon(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalate;silicon(4+)?
The IUPAC name of oxalate;silicon(4+) (CID 19840044) is oxalate;silicon(4+).
What is the SMILES notation for oxalate;silicon(4+)?
The canonical SMILES for oxalate;silicon(4+) is O=C([O-])C(=O)[O-].O=C([O-])C(=O)[O-].[SiH8+4].
What is the InChIKey of oxalate;silicon(4+)?
The InChIKey is JCGBUPUXFOYNQF-UHFFFAOYSA-J. The full InChI is InChI=1S/2C2H2O4.H8Si/c2*3-1(4)2(5)6;/h2*(H,3,4)(H,5,6);1H8/q;;+4/p-4.
What are the key properties of oxalate;silicon(4+)?
oxalate;silicon(4+) has a molecular weight of 212.19 g/mol, XLogP of -9.55, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for oxalate;silicon(4+) is sourced from PubChem (CID 19840044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).