About diazanium;zirconium;carbonate
diazanium;zirconium;carbonate (PubChem CID 174529437) has the molecular formula CH8N2O3Zr2
and a molecular weight of 278.53 g/mol. Its IUPAC name is diazanium;zirconium;carbonate.
Molecular Properties
| Compound Name | diazanium;zirconium;carbonate |
| PubChem CID | 174529437 |
| Molecular Formula | CH8N2O3Zr2 |
| Molecular Weight | 278.53 g/mol |
| Exact Mass | 275.86 |
| IUPAC Name | diazanium;zirconium;carbonate |
| SMILES | O=C([O-])[O-].[NH4+].[NH4+].[Zr].[Zr] |
| InChI | InChI=1S/CH2O3.2H3N.2Zr/c2-1(3)4;;;;/h(H2,2,3,4);2*1H3;; |
| InChIKey | YVHFEYIKHKLASM-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.53 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze diazanium;zirconium;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;zirconium;carbonate?
The IUPAC name of diazanium;zirconium;carbonate (CID 174529437) is diazanium;zirconium;carbonate.
What is the SMILES notation for diazanium;zirconium;carbonate?
The canonical SMILES for diazanium;zirconium;carbonate is O=C([O-])[O-].[NH4+].[NH4+].[Zr].[Zr].
What is the InChIKey of diazanium;zirconium;carbonate?
The InChIKey is YVHFEYIKHKLASM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.2H3N.2Zr/c2-1(3)4;;;;/h(H2,2,3,4);2*1H3;;.
What are the key properties of diazanium;zirconium;carbonate?
diazanium;zirconium;carbonate has a molecular weight of 278.53 g/mol, XLogP of -1.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;zirconium;carbonate is sourced from PubChem (CID 174529437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).