About plutonium dicarbonate
plutonium dicarbonate (PubChem CID 22099017) has the molecular formula C2O6Pu-4
and a molecular weight of 364.02 g/mol. Its IUPAC name is plutonium dicarbonate.
Molecular Properties
| Compound Name | plutonium dicarbonate |
| PubChem CID | 22099017 |
| Molecular Formula | C2O6Pu-4 |
| Molecular Weight | 364.02 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | plutonium dicarbonate |
| SMILES | O=C([O-])[O-].O=C([O-])[O-].[Pu] |
| InChI | InChI=1S/2CH2O3.Pu/c2*2-1(3)4;/h2*(H2,2,3,4);/p-4 |
| InChIKey | VFWAWQQEACZKER-UHFFFAOYSA-J |
| XLogP | -4.89 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.02 |
| LogP ≤ 5 | -4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze plutonium dicarbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of plutonium dicarbonate?
The IUPAC name of plutonium dicarbonate (CID 22099017) is plutonium dicarbonate.
What is the SMILES notation for plutonium dicarbonate?
The canonical SMILES for plutonium dicarbonate is O=C([O-])[O-].O=C([O-])[O-].[Pu].
What is the InChIKey of plutonium dicarbonate?
The InChIKey is VFWAWQQEACZKER-UHFFFAOYSA-J. The full InChI is InChI=1S/2CH2O3.Pu/c2*2-1(3)4;/h2*(H2,2,3,4);/p-4.
What are the key properties of plutonium dicarbonate?
plutonium dicarbonate has a molecular weight of 364.02 g/mol, XLogP of -4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for plutonium dicarbonate is sourced from PubChem (CID 22099017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).