About cadmium(2+);λ2-plumbane;carbonate
cadmium(2+);λ2-plumbane;carbonate (PubChem CID 174815028) has the molecular formula CH2CdO3Pb
and a molecular weight of 381.64 g/mol. Its IUPAC name is cadmium(2+);λ2-plumbane;carbonate.
Molecular Properties
| Compound Name | cadmium(2+);λ2-plumbane;carbonate |
| PubChem CID | 174815028 |
| Molecular Formula | CH2CdO3Pb |
| Molecular Weight | 381.64 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | cadmium(2+);λ2-plumbane;carbonate |
| SMILES | O=C([O-])[O-].[Cd+2].[PbH2] |
| InChI | InChI=1S/CH2O3.Cd.Pb.2H/c2-1(3)4;;;;/h(H2,2,3,4);;;;/q;+2;;;/p-2 |
| InChIKey | BDPNDZYLPBDLEF-UHFFFAOYSA-L |
| XLogP | -3.37 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.64 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cadmium(2+);λ2-plumbane;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);λ2-plumbane;carbonate?
The IUPAC name of cadmium(2+);λ2-plumbane;carbonate (CID 174815028) is cadmium(2+);λ2-plumbane;carbonate.
What is the SMILES notation for cadmium(2+);λ2-plumbane;carbonate?
The canonical SMILES for cadmium(2+);λ2-plumbane;carbonate is O=C([O-])[O-].[Cd+2].[PbH2].
What is the InChIKey of cadmium(2+);λ2-plumbane;carbonate?
The InChIKey is BDPNDZYLPBDLEF-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Cd.Pb.2H/c2-1(3)4;;;;/h(H2,2,3,4);;;;/q;+2;;;/p-2.
What are the key properties of cadmium(2+);λ2-plumbane;carbonate?
cadmium(2+);λ2-plumbane;carbonate has a molecular weight of 381.64 g/mol, XLogP of -3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);λ2-plumbane;carbonate is sourced from PubChem (CID 174815028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).